CAS 1159823-50-3 is the registry number for 5-Aminoethyl-1-boc-indole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 5-(2-aminoethyl)indole-1-carboxylate;hydrochloride (CAS 1159823-50-3) is a chemical compound with the molecular formula C15H21ClN2O2 and a molecular weight of 296.79 g/mol. IUPAC name: tert-butyl 5-(2-aminoethyl)indole-1-carboxylate;hydrochloride. InChIKey: MYUXVSOQEVWKDE-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O2 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | tert-butyl 5-(2-aminoethyl)indole-1-carboxylate;hydrochloride |
| InChIKey | MYUXVSOQEVWKDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=CC(=C2)CCN.Cl |
Computed by PubChem (NCBI)