CAS 886767-49-3 appears in our catalog under these names: tert-Butyl 3-(4-chlorophenyl)piperazine-1-carboxylate, 95%, 95%, 3-(4-Chlorophenyl)piperazine-1-carboxylic acid tert-butyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl 3-(4-chlorophenyl)piperazine-1-carboxylate (CAS 886767-49-3) is a chemical compound with the molecular formula C15H21ClN2O2 and a molecular weight of 296.79 g/mol. IUPAC name: tert-butyl 3-(4-chlorophenyl)piperazine-1-carboxylate. InChIKey: WWWIVVADARKSAS-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O2 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | tert-butyl 3-(4-chlorophenyl)piperazine-1-carboxylate |
| InChIKey | WWWIVVADARKSAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)