cas: 71666-05-2 — see every product listed under this CAS number, including other names
cis-2-(Ethoxycarbonyl)cyclopropane carboxylic acid, 95%, 95% (CAS 71666-05-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IC7O-250mg |
| cas | 71666-05-2 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 731.60 Pln | |
| Chemat | 1g | 1816.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Cis-(1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid (CAS 71666-05-2) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: BRVQFDJETHFEQY-CRCLSJGQSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | BRVQFDJETHFEQY-CRCLSJGQSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)