cis-2-(Ethoxycarbonyl)cyclopropanecarboxylic acid 95%
cas: 71666-05-2 — see every product listed under this CAS number, including other names
cis-2-(Ethoxycarbonyl)cyclopropanecarboxylic acid 95% (CAS 71666-05-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A603446-250mg |
| cas | 71666-05-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 826.50 Pln | |
| Ambeed | 1g | 2050.25 Pln | |
| Ambeed | 5g | 7045.38 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A603446 |
Cis-(1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid (CAS 71666-05-2) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: BRVQFDJETHFEQY-CRCLSJGQSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | BRVQFDJETHFEQY-CRCLSJGQSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
cis-2-(Ethoxycarbonyl)cyclopropane carboxylic acid, (1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid, cis-2-(Ethoxycarbonyl)cyclopropanecarboxylic acid, (1S,2R)-2-ethoxycarbonylcyclopropanecarboxylic acid, cis-1,2-Cyclopropanedicarboxylic acid mono ethyl ester, rel-(1s,2r)-2-(Ethoxycarbonyl)cyclopropane-1-carboxylic acid, 1,2-Cyclopropanedicarboxylic acid, monoethyl ester, (1R,2S)-rel- (9CI)