cis-3-Hydroxycyclohexanecarboxylic acid, 97%
cas: 22267-35-2 — see every product listed under this CAS number, including other names
cis-3-Hydroxycyclohexanecarboxylic acid, 97% (CAS 22267-35-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1225202-250mg |
| cas | 22267-35-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1432.81 Pln | |
| Ambeed | 5g | 4592.31 Pln | |
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 500mg | 851.60 Pln | |
| Chemat | 1g | 1010.00 Pln | |
| Chemat | 5g | 3414.80 Pln | |
| Chemat | 500mg | 851.60 Pln | |
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1010.00 Pln | |
| Chemat | 5g | 3414.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid (CAS 22267-35-2) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid. InChIKey: JBZDHFKPEDWWJC-RITPCOANSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid |
| InChIKey | JBZDHFKPEDWWJC-RITPCOANSA-N |
| SMILES | C1C[C@H](C[C@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)