cas: 31420-52-7 — see every product listed under this CAS number, including other names
cis-Cyclobutane-1,2-dicarboxylic acid monomethyl ester, 98% (CAS 31420-52-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552187-250MG |
| cas | 31420-52-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 500mg | 508.17 Pln | |
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 5g | 2122.19 Pln | |
| Fluorochem | 10g | 3762.23 Pln | |
| Fluorochem | 25g | 8479.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid (CAS 31420-52-7) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid. InChIKey: DLSMGFKPSMYVFW-UHNVWZDZSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid |
| InChIKey | DLSMGFKPSMYVFW-UHNVWZDZSA-N |
| SMILES | COC(=O)[C@H]1CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)