CAS 31420-60-7 appears in our catalog under these names: Trans-2-(methoxycarbonyl)cyclobutanecarboxylic acid, 96%, trans-2-(methoxycarbonyl)cyclobutanecarboxylic acid, 97%, rac-(1R,2R)-2-(Methoxycarbonyl)cyclobutane-1-carboxylic acid, trans-2-(methoxycarbonyl)cyclobutanecarboxylic acid, 97%, 97%, trans-2-(methoxycarbonyl)cyclobutanecarboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 0,5g, 100mg, 500mg, 25g.
Trans-(1R,2R)-2-methoxycarbonylcyclobutane-1-carboxylic acid (CAS 31420-60-7) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: trans-(1R,2R)-2-methoxycarbonylcyclobutane-1-carboxylic acid. InChIKey: DLSMGFKPSMYVFW-RFZPGFLSSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | trans-(1R,2R)-2-methoxycarbonylcyclobutane-1-carboxylic acid |
| InChIKey | DLSMGFKPSMYVFW-RFZPGFLSSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)