CAS 88335-89-1 is the registry number for (1R,2S)-2-(Methoxycarbonyl)cyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid (CAS 88335-89-1) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid. InChIKey: DLSMGFKPSMYVFW-UHNVWZDZSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid |
| InChIKey | DLSMGFKPSMYVFW-UHNVWZDZSA-N |
| SMILES | COC(=O)[C@H]1CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)