Products 88335-89-1

CAS 88335-89-1 is the registry number for (1R,2S)-2-(Methoxycarbonyl)cyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid (CAS 88335-89-1) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid. InChIKey: DLSMGFKPSMYVFW-UHNVWZDZSA-N.

Identity
Molecular formulaC7H10O4
Molecular weight158.15 g/mol
IUPAC namecis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid
InChIKeyDLSMGFKPSMYVFW-UHNVWZDZSA-N
SMILESCOC(=O)[C@H]1CC[C@H]1C(=O)O

Computed by PubChem (NCBI)