CAS 31420-52-7 appears in our catalog under these names: (1R,2S)-2-Methoxycarbonylcyclobutanecarboxylic acid, 95%, rac-(1R,2S)-2-(methoxycarbonyl)cyclobutane-1-carboxylic acid, cis, cis-2-(Methoxycarbonyl)cyclobutanecarboxylic acid, 97%, 97%, cis-Cyclobutane-1,2-dicarboxylic acid monomethyl ester, 98%, cis-2-(Methoxycarbonyl)cyclobutanecarboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 2,5g, 250mg, 100mg, 500mg, 5g, 10g, 25g.
Cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid (CAS 31420-52-7) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid. InChIKey: DLSMGFKPSMYVFW-UHNVWZDZSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid |
| InChIKey | DLSMGFKPSMYVFW-UHNVWZDZSA-N |
| SMILES | COC(=O)[C@H]1CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)