cas: 1461-96-7 — see every product listed under this CAS number, including other names
cis-Cyclopentane-1,2-dicarboxylic acid, 97%, 97% (CAS 1461-96-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DPL-100mg |
| cas | 1461-96-7 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 496.40 Pln | |
| Chemat | 25g | 2147.60 Pln | |
| Chemat | 100g | 8229.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Cis-(1S,2R)-cyclopentane-1,2-dicarboxylic acid (CAS 1461-96-7) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1S,2R)-cyclopentane-1,2-dicarboxylic acid. InChIKey: ASJCSAKCMTWGAH-SYDPRGILSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1S,2R)-cyclopentane-1,2-dicarboxylic acid |
| InChIKey | ASJCSAKCMTWGAH-SYDPRGILSA-N |
| SMILES | C1C[C@H]([C@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)