cis-Cyclopentane-1,2-dicarboxylic acid, 97%
cas: 1461-96-7 — see every product listed under this CAS number, including other names
cis-Cyclopentane-1,2-dicarboxylic acid, 97% (CAS 1461-96-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 25g, 100g, 100mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F033881-250MG |
| cas | 1461-96-7 |
| size | 250mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 2.5g | 393.63 Pln | |
| Fluorochem | 5g | 695.61 Pln | |
| Fluorochem | 25g | 3173.90 Pln | |
| Fluorochem | 100g | 11566.78 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 676.31 Pln | |
| Ambeed | 25g | 3084.88 Pln | |
| Ambeed | 100g | 12129.50 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 496.40 Pln | |
| Chemat | 25g | 2147.60 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Cis-(1S,2R)-cyclopentane-1,2-dicarboxylic acid (CAS 1461-96-7) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1S,2R)-cyclopentane-1,2-dicarboxylic acid. InChIKey: ASJCSAKCMTWGAH-SYDPRGILSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1S,2R)-cyclopentane-1,2-dicarboxylic acid |
| InChIKey | ASJCSAKCMTWGAH-SYDPRGILSA-N |
| SMILES | C1C[C@H]([C@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
cis-Cyclopentane-1,2-dicarboxylic acid, cis-1,2-cyclopentanedicarboxylic acid, 1,2-Cyclopentanedicarboxylic acid, (1R,2S)-rel-, (1S,2R)-cyclopentane-1,2-dicarboxylic acid, (1R,2S)-rel-1,2-Cyclopentanedicarboxylic Acid, (1r,2s)-cyclopentane-1,2-dicarboxylic acid, (+/-)-cis-Cyclopentane-1,2-dicarboxylic acid, ASJCSAKCMTWGAH-SYDPRGILSA-N, cis-1, 2-cyclopentanedicarboxylic acid, cis-1,2-cyclopentanedicarbo xylic acid