CAS 1461-96-7 appears in our catalog under these names: Cis-cyclopentane-1,2-dicarboxylic acid, 95%, Cis-Cyclopentane-1,2-dicarboxylic acid, (1R,2S)-rel-1,2-Cyclopentanedicarboxylic Acid, cis-Cyclopentane-1,2-dicarboxylic acid 97%, cis-Cyclopentane-1,2-dicarboxylic acid, 97%, 97%. Offered by: Combi-blocks, Triz Pharma-Tech, TRC, Ambeed, Chemat. Available pack sizes: 5g, 1g, on request, 100mg, 250mg, 25g, 100g, 2.5g.
Cis-(1S,2R)-cyclopentane-1,2-dicarboxylic acid (CAS 1461-96-7) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1S,2R)-cyclopentane-1,2-dicarboxylic acid. InChIKey: ASJCSAKCMTWGAH-SYDPRGILSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1S,2R)-cyclopentane-1,2-dicarboxylic acid |
| InChIKey | ASJCSAKCMTWGAH-SYDPRGILSA-N |
| SMILES | C1C[C@H]([C@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)