cas: 1630906-51-2 — see every product listed under this CAS number, including other names
cyclobutanamine, 3-(4-fluoro-2-methoxyphenoxy)-, hydrochloride (1:1), trans-, 97%, 97% (CAS 1630906-51-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TP3-100mg |
| cas | 1630906-51-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 866.00 Pln | |
| Chemat | 250mg | 1134.80 Pln | |
| Chemat | 500mg | 1845.20 Pln | |
| Chemat | 1g | 2733.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(4-fluoro-2-methoxyphenoxy)cyclobutan-1-amine;hydrochloride (CAS 1630906-51-2) is a chemical compound with the molecular formula C11H15ClFNO2 and a molecular weight of 247.69 g/mol. IUPAC name: 3-(4-fluoro-2-methoxyphenoxy)cyclobutan-1-amine;hydrochloride. InChIKey: DCEJUCWVODQEBP-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO2 |
|---|---|
| Molecular weight | 247.69 g/mol |
| IUPAC name | 3-(4-fluoro-2-methoxyphenoxy)cyclobutan-1-amine;hydrochloride |
| InChIKey | DCEJUCWVODQEBP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)F)OC2CC(C2)N.Cl |
Computed by PubChem (NCBI)