cas: 142717-44-0 — see every product listed under this CAS number, including other names
ethyl 2-[4-(benzyloxy)phenoxy]acetate, 95%, 95% (CAS 142717-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110JRH-100mg |
| cas | 142717-44-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1370.00 Pln | |
| Chemat | 1g | 2680.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(4-phenylmethoxyphenoxy)acetate (CAS 142717-44-0) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 286.32 g/mol. IUPAC name: ethyl 2-(4-phenylmethoxyphenoxy)acetate. InChIKey: MYSLHCQKSBLMAR-UHFFFAOYSA-N.
| Molecular formula | C17H18O4 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | ethyl 2-(4-phenylmethoxyphenoxy)acetate |
| InChIKey | MYSLHCQKSBLMAR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)