cas: 649557-55-1 — see every product listed under this CAS number, including other names
ethyl 4-(4-cyanophenyl)-2-hydroxy-4-oxobut-2-enoate, 97% (CAS 649557-55-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F654852-50MG |
| cas | 649557-55-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 325.94 Pln | |
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 500mg | 1591.12 Pln | |
| Fluorochem | 1g | 1794.18 Pln | |
| Fluorochem | 2.5g | 3845.54 Pln | |
| Fluorochem | 5g | 5850.04 Pln | |
| Fluorochem | 10g | 11634.46 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-(4-cyanophenyl)-2,4-dioxobutanoate (CAS 649557-55-1) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: ethyl 4-(4-cyanophenyl)-2,4-dioxobutanoate. InChIKey: NAFLGJUISVNDKT-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | ethyl 4-(4-cyanophenyl)-2,4-dioxobutanoate |
| InChIKey | NAFLGJUISVNDKT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)