cas: 120732-04-9 — see every product listed under this CAS number, including other names
ethyl 4-(trifluoromethyl)-1H-pyrrole-3-carboxylate, 97% (CAS 120732-04-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601693-100MG |
| cas | 120732-04-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 378.01 Pln | |
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 1g | 987.17 Pln | |
| Fluorochem | 5g | 4715.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-(trifluoromethyl)-1H-pyrrole-3-carboxylate (CAS 120732-04-9) is a chemical compound with the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. IUPAC name: ethyl 4-(trifluoromethyl)-1H-pyrrole-3-carboxylate. InChIKey: OPRFQUCZHDBZHE-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO2 |
|---|---|
| Molecular weight | 207.15 g/mol |
| IUPAC name | ethyl 4-(trifluoromethyl)-1H-pyrrole-3-carboxylate |
| InChIKey | OPRFQUCZHDBZHE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC=C1C(F)(F)F |
Computed by PubChem (NCBI)