CAS 219726-59-7 is the registry number for 3-(4,5-Dimethyloxazol-2-yl)-1,1,1-trifluoropropan-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4,5-dimethyl-1,3-oxazol-2-yl)-1,1,1-trifluoropropan-2-one (CAS 219726-59-7) is a chemical compound with the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. IUPAC name: 3-(4,5-dimethyl-1,3-oxazol-2-yl)-1,1,1-trifluoropropan-2-one. InChIKey: PFRDWYMBQDPMLD-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO2 |
|---|---|
| Molecular weight | 207.15 g/mol |
| IUPAC name | 3-(4,5-dimethyl-1,3-oxazol-2-yl)-1,1,1-trifluoropropan-2-one |
| InChIKey | PFRDWYMBQDPMLD-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)CC(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)