Products 124432-61-7
CAS 124432-61-7 appears in our catalog under these names: 2,3-Dimethoxy-5-(trifluoromethyl)pyridine, 95%, 2,3-Dimethoxy-5-(trifluoromethyl)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2,3-dimethoxy-5-(trifluoromethyl)pyridine (CAS 124432-61-7) is a chemical compound with the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. IUPAC name: 2,3-dimethoxy-5-(trifluoromethyl)pyridine. InChIKey: YGZKUUOTWBKZIM-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO2 |
|---|---|
| Molecular weight | 207.15 g/mol |
| IUPAC name | 2,3-dimethoxy-5-(trifluoromethyl)pyridine |
| InChIKey | YGZKUUOTWBKZIM-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC(=C1)C(F)(F)F)OC |
Computed by PubChem (NCBI)