CAS 131395-23-8 appears in our catalog under these names: 2-Methoxy-4-(trifluoromethoxy)aniline, 95%, 2-Methoxy-4-(trifluoromethoxy)aniline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-methoxy-4-(trifluoromethoxy)aniline (CAS 131395-23-8) is a chemical compound with the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. IUPAC name: 2-methoxy-4-(trifluoromethoxy)aniline. InChIKey: UHSZMPDNKZEQRZ-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO2 |
|---|---|
| Molecular weight | 207.15 g/mol |
| IUPAC name | 2-methoxy-4-(trifluoromethoxy)aniline |
| InChIKey | UHSZMPDNKZEQRZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)OC(F)(F)F)N |
Computed by PubChem (NCBI)