Products 2166801-66-5
CAS 2166801-66-5 is the registry number for methyl 5-bromo-6-methylbenzo[b]thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 5-bromo-6-methyl-1-benzothiophene-2-carboxylate (CAS 2166801-66-5) is a chemical compound with the molecular formula C11H9BrO2S and a molecular weight of 285.16 g/mol. IUPAC name: methyl 5-bromo-6-methyl-1-benzothiophene-2-carboxylate. InChIKey: DUAQDOGBUYHXJP-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2S |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | methyl 5-bromo-6-methyl-1-benzothiophene-2-carboxylate |
| InChIKey | DUAQDOGBUYHXJP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)C=C(S2)C(=O)OC |
Computed by PubChem (NCBI)