Products 1029720-27-1
CAS 1029720-27-1 is the registry number for methyl 6-bromo-5-methylbenzo[b]thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Methyl 6-bromo-5-methyl-1-benzothiophene-2-carboxylate (CAS 1029720-27-1) is a chemical compound with the molecular formula C11H9BrO2S and a molecular weight of 285.16 g/mol. IUPAC name: methyl 6-bromo-5-methyl-1-benzothiophene-2-carboxylate. InChIKey: ZTORUZXHZOIFQI-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2S |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | methyl 6-bromo-5-methyl-1-benzothiophene-2-carboxylate |
| InChIKey | ZTORUZXHZOIFQI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)SC(=C2)C(=O)OC |
Computed by PubChem (NCBI)