CAS 784163-17-3 is the registry number for Ethyl 3-bromobenzo[b]thiophene-2-carboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 3-bromo-1-benzothiophene-2-carboxylate (CAS 784163-17-3) is a chemical compound with the molecular formula C11H9BrO2S and a molecular weight of 285.16 g/mol. IUPAC name: ethyl 3-bromo-1-benzothiophene-2-carboxylate. InChIKey: RLUIYHRFSJDYFH-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2S |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | ethyl 3-bromo-1-benzothiophene-2-carboxylate |
| InChIKey | RLUIYHRFSJDYFH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2S1)Br |
Computed by PubChem (NCBI)