cas: 50845-77-7 — see every product listed under this CAS number, including other names
ethyl N-(4-methoxyphenyl)glycinate, 97% (CAS 50845-77-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F392262-1G |
| cas | 50845-77-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 2.5g | 851.80 Pln | |
| Fluorochem | 5g | 1221.46 Pln | |
| Fluorochem | 10g | 1736.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2-(4-methoxyanilino)acetate (CAS 50845-77-7) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: ethyl 2-(4-methoxyanilino)acetate. InChIKey: TZJRPKDPYLAMJZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | ethyl 2-(4-methoxyanilino)acetate |
| InChIKey | TZJRPKDPYLAMJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)