cas: 280762-00-7 — see every product listed under this CAS number, including other names
exo-8-(tert-Butoxycarbonyl)-8-azabicyclo(3.2.1)octane-3-carboxylic acid, 97% (CAS 280762-00-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A277215-5g |
| cas | 280762-00-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7432.81 Pln | |
| AmBeed | 10g | 12386.92 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid (CAS 280762-00-7) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid. InChIKey: HKXICUDOIXLKLJ-PBINXNQUSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid |
| InChIKey | HKXICUDOIXLKLJ-PBINXNQUSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(C2)C(=O)O |
Computed by PubChem (NCBI)