cas: 280762-00-7 — see every product listed under this CAS number, including other names
exo-8-(tert-Butoxycarbonyl)-8-azabicyclo[3.2.1]octane-3-carboxylic acid, 95%, 95% (CAS 280762-00-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114A78-100mg |
| cas | 280762-00-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 500mg | 1178.00 Pln | |
| Chemat | 1g | 1619.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid (CAS 280762-00-7) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid. InChIKey: HKXICUDOIXLKLJ-PBINXNQUSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid |
| InChIKey | HKXICUDOIXLKLJ-PBINXNQUSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(C2)C(=O)O |
Computed by PubChem (NCBI)