Products 1644156-56-8
CAS 1644156-56-8 appears in our catalog under these names: hDHODH-IN-4/ 99.31% (existing batch purity), DHODH–IN–5, hDHODH-IN-4, hDHODH-IN-4, 99.73%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10 mg.
[1-(5-cyclopropylpyrimidin-2-yl)-5-methyl-3-propan-2-yloxypyrazol-4-yl]-phenylmethanol (CAS 1644156-56-8) is a chemical compound with the molecular formula C21H24N4O2 and a molecular weight of 364.4 g/mol. IUPAC name: [1-(5-cyclopropylpyrimidin-2-yl)-5-methyl-3-propan-2-yloxypyrazol-4-yl]-phenylmethanol. InChIKey: BSNKBAPMWCMENP-UHFFFAOYSA-N.
| Molecular formula | C21H24N4O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | [1-(5-cyclopropylpyrimidin-2-yl)-5-methyl-3-propan-2-yloxypyrazol-4-yl]-phenylmethanol |
| InChIKey | BSNKBAPMWCMENP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=NC=C(C=N2)C3CC3)OC(C)C)C(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)
Synonyms:
hDHODH-IN-4, orb1709877