Products 945762-00-5
CAS 945762-00-5 appears in our catalog under these names: iNOS-IN-14/ 99.68% (existing batch purity), nNOS–IN–1, nNOS-IN-1 95%, 3-Bromo-1H-indazole-7-carbonitrile, 98%, 98%, nNOS-IN-1, 99.53%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 50mg, 1g, 100mg, 250mg, 10mM (in 1ml dmso), 5g, 250 mg, 1 g.
3-bromo-2H-indazole-7-carbonitrile (CAS 945762-00-5) is a chemical compound with the molecular formula C8H4BrN3 and a molecular weight of 222.04 g/mol. IUPAC name: 3-bromo-2H-indazole-7-carbonitrile. InChIKey: MRGZUAUMTMLMTE-UHFFFAOYSA-N.
| Molecular formula | C8H4BrN3 |
|---|---|
| Molecular weight | 222.04 g/mol |
| IUPAC name | 3-bromo-2H-indazole-7-carbonitrile |
| InChIKey | MRGZUAUMTMLMTE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)C#N)Br |
Computed by PubChem (NCBI)