cas: 173600-03-8 — see every product listed under this CAS number, including other names
methyl 1-benzyl-1H-indazole-3-carboxylate, 95%, 95% (CAS 173600-03-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ARY4-100mg |
| cas | 173600-03-8 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2128.40 Pln | |
| Chemat | 250mg | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 1-benzylindazole-3-carboxylate (CAS 173600-03-8) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: methyl 1-benzylindazole-3-carboxylate. InChIKey: MDYQTFQMUAVGRX-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | methyl 1-benzylindazole-3-carboxylate |
| InChIKey | MDYQTFQMUAVGRX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)