cas: 1092350-71-4 — see every product listed under this CAS number, including other names
methyl 2-(1,5-naphthyridin-2-yl)acetate, 97%, 97% (CAS 1092350-71-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1100CB-100mg |
| cas | 1092350-71-4 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 923.60 Pln | |
| Chemat | 250mg | 1437.20 Pln | |
| Chemat | 500mg | 2358.80 Pln | |
| Chemat | 1g | 3501.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(1,5-naphthyridin-2-yl)acetate (CAS 1092350-71-4) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 2-(1,5-naphthyridin-2-yl)acetate. InChIKey: QJLYPVCCYRBJQC-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 2-(1,5-naphthyridin-2-yl)acetate |
| InChIKey | QJLYPVCCYRBJQC-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=NC2=C(C=C1)N=CC=C2 |
Computed by PubChem (NCBI)