cas: 68-34-8 — see every product listed under this CAS number, including other names
p-Toluenesulfonanilide, 98%, 98% (CAS 68-34-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114U1V-5g |
| cas | 68-34-8 |
| size | 5g |
| availability | 800g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 318.80 Pln | |
| Chemat | 500g | 1339.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methyl-N-phenylbenzenesulfonamide (CAS 68-34-8) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: 4-methyl-N-phenylbenzenesulfonamide. InChIKey: VLVCWODDMDGANW-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | 4-methyl-N-phenylbenzenesulfonamide |
| InChIKey | VLVCWODDMDGANW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)