CAS 100-29-8 appears in our catalog under these names: 4-Nitrophenetole, 98%, 4-Nitrophenetole, 4-Nitrophenetole, >98.0%(GC). Offered by: Combi-blocks, Hubei YoungXin, TCI. Available pack sizes: 25g, 5g, 1g, 100g, 10mg, 25mg, 50mg, 100mg.
1-ethoxy-4-nitrobenzene (CAS 100-29-8) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 1-ethoxy-4-nitrobenzene. InChIKey: NWPKEYHUZKMWKJ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 1-ethoxy-4-nitrobenzene |
| InChIKey | NWPKEYHUZKMWKJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)