CAS 1000068-25-6 appears in our catalog under these names: 1-BOC-4-fluoroindole-2-boronic acid, 95%, (1-(tert-Butoxycarbonyl)-4-fluoro-1H-indol-2-yl)boronic acid 97%, (1-(tert-Butoxycarbonyl)-4-fluoro-1H-indol-2-yl)boronic acid, 97%, 97%, (1-(tert-Butoxycarbonyl)-4-fluoro-1H-indol-2-yl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg.
[4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 1000068-25-6) is a chemical compound with the molecular formula C13H15BFNO4 and a molecular weight of 279.07 g/mol. IUPAC name: [4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: GIHZCAVQMVZATP-UHFFFAOYSA-N.
| Molecular formula | C13H15BFNO4 |
|---|---|
| Molecular weight | 279.07 g/mol |
| IUPAC name | [4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | GIHZCAVQMVZATP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC=C2F)(O)O |
Computed by PubChem (NCBI)