CAS 1000068-65-4 is the registry number for (1-(tert-Butoxycarbonyl)-7-fluoro-1H-indol-2-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[7-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 1000068-65-4) is a chemical compound with the molecular formula C13H15BFNO4 and a molecular weight of 279.07 g/mol. IUPAC name: [7-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: AHFAZIPJGLAFSE-UHFFFAOYSA-N.
| Molecular formula | C13H15BFNO4 |
|---|---|
| Molecular weight | 279.07 g/mol |
| IUPAC name | [7-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | AHFAZIPJGLAFSE-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C(=CC=C2)F)(O)O |
Computed by PubChem (NCBI)