CAS 1000068-26-7 appears in our catalog under these names: N-(Boc)-6-fluoroindole-2-boronic acid, 98%, (1–(tert–Butoxycarbonyl)–6–fluoro–1H–indol–2–yl)boronic acid, (1-(tert-Butoxycarbonyl)-6-fluoro-1H-indol-2-yl)boronic acid 98%, (1-(tert-Butoxycarbonyl)-6-fluoro-2-indolyl)boronic acid, 98%, 98%, 1-Boc-6-Fluoro-1H-indole-2-boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
[6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 1000068-26-7) is a chemical compound with the molecular formula C13H15BFNO4 and a molecular weight of 279.07 g/mol. IUPAC name: [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: GARRUKBUEWVRCV-UHFFFAOYSA-N.
| Molecular formula | C13H15BFNO4 |
|---|---|
| Molecular weight | 279.07 g/mol |
| IUPAC name | [6-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | GARRUKBUEWVRCV-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)