Products 1000207-40-8
CAS 1000207-40-8 is the registry number for tert-Butyl 4-((2,6-dichloropyrimidin-4-yl)amino)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 5g, 10g.
Tert-butyl 4-[(2,6-dichloropyrimidin-4-yl)amino]piperidine-1-carboxylate (CAS 1000207-40-8) is a chemical compound with the molecular formula C14H20Cl2N4O2 and a molecular weight of 347.2 g/mol. IUPAC name: tert-butyl 4-[(2,6-dichloropyrimidin-4-yl)amino]piperidine-1-carboxylate. InChIKey: MLGAMHFRGRYMNO-UHFFFAOYSA-N.
| Molecular formula | C14H20Cl2N4O2 |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | tert-butyl 4-[(2,6-dichloropyrimidin-4-yl)amino]piperidine-1-carboxylate |
| InChIKey | MLGAMHFRGRYMNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NC2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)