Products 1821293-56-4
CAS 1821293-56-4 is the registry number for tert-Butyl (R)-4-(2,4-dichloropyrimidin-5-yl)-2-methylpiperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R)-4-(2,4-dichloropyrimidin-5-yl)-2-methylpiperazine-1-carboxylate (CAS 1821293-56-4) is a chemical compound with the molecular formula C14H20Cl2N4O2 and a molecular weight of 347.2 g/mol. IUPAC name: tert-butyl (2R)-4-(2,4-dichloropyrimidin-5-yl)-2-methylpiperazine-1-carboxylate. InChIKey: FTEKHNAXFZQLCK-SECBINFHSA-N.
| Molecular formula | C14H20Cl2N4O2 |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | tert-butyl (2R)-4-(2,4-dichloropyrimidin-5-yl)-2-methylpiperazine-1-carboxylate |
| InChIKey | FTEKHNAXFZQLCK-SECBINFHSA-N |
| SMILES | C[C@@H]1CN(CCN1C(=O)OC(C)(C)C)C2=CN=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)