Products 2985338-61-0
CAS 2985338-61-0 appears in our catalog under these names: D-Cl-amidine (hydrochloride), 95%, 95%, D-Cl-amidine (hydrochloride), 99.91%, D-Cl-amidine (hydrochloride) (Standard). Offered by: Chemat, MedChemExpress. Available pack sizes: 1g, 100 mg, 50 mg, 25 mg, 5 mg, 10 mg, 10mM/1mL, Get quote.
N-[(2R)-1-amino-5-[(1-amino-2-chloroethylidene)amino]-1-oxopentan-2-yl]benzamide;hydrochloride (CAS 2985338-61-0) is a chemical compound with the molecular formula C14H20Cl2N4O2 and a molecular weight of 347.2 g/mol. IUPAC name: N-[(2R)-1-amino-5-[(1-amino-2-chloroethylidene)amino]-1-oxopentan-2-yl]benzamide;hydrochloride. InChIKey: OPFMEGSAOZAJIV-RFVHGSKJSA-N.
| Molecular formula | C14H20Cl2N4O2 |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | N-[(2R)-1-amino-5-[(1-amino-2-chloroethylidene)amino]-1-oxopentan-2-yl]benzamide;hydrochloride |
| InChIKey | OPFMEGSAOZAJIV-RFVHGSKJSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@H](CCCN=C(CCl)N)C(=O)N.Cl |
Computed by PubChem (NCBI)