Products 1000518-49-9
CAS 1000518-49-9 is the registry number for 2-(2-Chloro-3-methylphenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(2-chloro-3-methylphenyl)acetic acid (CAS 1000518-49-9) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 2-(2-chloro-3-methylphenyl)acetic acid. InChIKey: YBGVTNVOWFYDLN-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 2-(2-chloro-3-methylphenyl)acetic acid |
| InChIKey | YBGVTNVOWFYDLN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CC(=O)O)Cl |
Computed by PubChem (NCBI)