Products 1000526-63-5
CAS 1000526-63-5 is the registry number for 4-Methyl-3-(trifluoromethyl)phenylacetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
2-[4-methyl-3-(trifluoromethyl)phenyl]acetonitrile (CAS 1000526-63-5) is a chemical compound with the molecular formula C10H8F3N and a molecular weight of 199.17 g/mol. IUPAC name: 2-[4-methyl-3-(trifluoromethyl)phenyl]acetonitrile. InChIKey: FAFXSMKZLPNZEQ-UHFFFAOYSA-N.
| Molecular formula | C10H8F3N |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | 2-[4-methyl-3-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | FAFXSMKZLPNZEQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC#N)C(F)(F)F |
Computed by PubChem (NCBI)