CAS 1314924-22-5 is the registry number for 1-(4-Ethynylphenyl)-2,2,2-trifluoroethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-ethynylphenyl)-2,2,2-trifluoroethanamine (CAS 1314924-22-5) is a chemical compound with the molecular formula C10H8F3N and a molecular weight of 199.17 g/mol. IUPAC name: 1-(4-ethynylphenyl)-2,2,2-trifluoroethanamine. InChIKey: FGPOIHGLQQKTIZ-UHFFFAOYSA-N.
| Molecular formula | C10H8F3N |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | 1-(4-ethynylphenyl)-2,2,2-trifluoroethanamine |
| InChIKey | FGPOIHGLQQKTIZ-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C(C(F)(F)F)N |
Computed by PubChem (NCBI)