CAS 1609975-36-1 is the registry number for 3-(2,2-Difluoroethyl)-5-fluoro-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(2,2-difluoroethyl)-5-fluoro-1H-indole (CAS 1609975-36-1) is a chemical compound with the molecular formula C10H8F3N and a molecular weight of 199.17 g/mol. IUPAC name: 3-(2,2-difluoroethyl)-5-fluoro-1H-indole. InChIKey: UEKGEDKJZJCNMY-UHFFFAOYSA-N.
| Molecular formula | C10H8F3N |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | 3-(2,2-difluoroethyl)-5-fluoro-1H-indole |
| InChIKey | UEKGEDKJZJCNMY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)CC(F)F |
Computed by PubChem (NCBI)