CAS 1000573-68-1 is the registry number for Ethyl 1-(4-fluorophenyl)-5-oxo-2,5-dihydro-1H-1,2,4-triazole-3-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 1-(4-fluorophenyl)-5-oxo-4H-1,2,4-triazole-3-carboxylate (CAS 1000573-68-1) is a chemical compound with the molecular formula C11H10FN3O3 and a molecular weight of 251.21 g/mol. IUPAC name: ethyl 1-(4-fluorophenyl)-5-oxo-4H-1,2,4-triazole-3-carboxylate. InChIKey: IKAUVQODZYXCQR-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3O3 |
|---|---|
| Molecular weight | 251.21 g/mol |
| IUPAC name | ethyl 1-(4-fluorophenyl)-5-oxo-4H-1,2,4-triazole-3-carboxylate |
| InChIKey | IKAUVQODZYXCQR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=O)N1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)