Products 2511713-93-0
CAS 2511713-93-0 is the registry number for 4-(2-Fluoro-4-methoxy-5-nitrophenyl)-1-methyl-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-fluoro-4-methoxy-5-nitrophenyl)-1-methylpyrazole (CAS 2511713-93-0) is a chemical compound with the molecular formula C11H10FN3O3 and a molecular weight of 251.21 g/mol. IUPAC name: 4-(2-fluoro-4-methoxy-5-nitrophenyl)-1-methylpyrazole. InChIKey: BOGMMLTXEQDALZ-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3O3 |
|---|---|
| Molecular weight | 251.21 g/mol |
| IUPAC name | 4-(2-fluoro-4-methoxy-5-nitrophenyl)-1-methylpyrazole |
| InChIKey | BOGMMLTXEQDALZ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CC(=C(C=C2F)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)