CAS 1910957-41-3 is the registry number for CRBN ligand-204. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2,6-dioxopiperidin-3-yl)-5-fluoropyridine-2-carboxamide (CAS 1910957-41-3) is a chemical compound with the molecular formula C11H10FN3O3 and a molecular weight of 251.21 g/mol. IUPAC name: N-(2,6-dioxopiperidin-3-yl)-5-fluoropyridine-2-carboxamide. InChIKey: JEWJVXMERFKQQV-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3O3 |
|---|---|
| Molecular weight | 251.21 g/mol |
| IUPAC name | N-(2,6-dioxopiperidin-3-yl)-5-fluoropyridine-2-carboxamide |
| InChIKey | JEWJVXMERFKQQV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC(=O)C2=NC=C(C=C2)F |
Computed by PubChem (NCBI)