CAS 1000577-60-5 appears in our catalog under these names: 2-Amino-5-bromo-3-chloro-6-fluorobenzonitrile, 97%, 2-Amino-5-bromo-3-chloro-6-fluorobenzonitrile, 93%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
2-amino-5-bromo-3-chloro-6-fluorobenzonitrile (CAS 1000577-60-5) is a chemical compound with the molecular formula C7H3BrClFN2 and a molecular weight of 249.47 g/mol. IUPAC name: 2-amino-5-bromo-3-chloro-6-fluorobenzonitrile. InChIKey: IRFNZWZNSTWZMB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFN2 |
|---|---|
| Molecular weight | 249.47 g/mol |
| IUPAC name | 2-amino-5-bromo-3-chloro-6-fluorobenzonitrile |
| InChIKey | IRFNZWZNSTWZMB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)C#N)N)Cl |
Computed by PubChem (NCBI)