CAS 2637388-64-6 is the registry number for 3-Bromo-6-chloro-4-fluoro-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-6-chloro-4-fluoro-1H-pyrrolo[2,3-b]pyridine (CAS 2637388-64-6) is a chemical compound with the molecular formula C7H3BrClFN2 and a molecular weight of 249.47 g/mol. IUPAC name: 3-bromo-6-chloro-4-fluoro-1H-pyrrolo[2,3-b]pyridine. InChIKey: XPXBSVTVNJVRGH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFN2 |
|---|---|
| Molecular weight | 249.47 g/mol |
| IUPAC name | 3-bromo-6-chloro-4-fluoro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | XPXBSVTVNJVRGH-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(NC=C2Br)N=C1Cl)F |
Computed by PubChem (NCBI)