CAS 1935558-98-7 appears in our catalog under these names: 4-Bromo-7-chloro-6-fluoro-1h-indazole, 95%, 4–Bromo–7–chloro–6–fluoro–1H–indazole, 4-Bromo-7-chloro-6-fluoro-1H-indazole, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g.
4-bromo-7-chloro-6-fluoro-1H-indazole (CAS 1935558-98-7) is a chemical compound with the molecular formula C7H3BrClFN2 and a molecular weight of 249.47 g/mol. IUPAC name: 4-bromo-7-chloro-6-fluoro-1H-indazole. InChIKey: FFUFQPHQBDTNDB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFN2 |
|---|---|
| Molecular weight | 249.47 g/mol |
| IUPAC name | 4-bromo-7-chloro-6-fluoro-1H-indazole |
| InChIKey | FFUFQPHQBDTNDB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C(=C1Br)C=NN2)Cl)F |
Computed by PubChem (NCBI)