CAS 1000577-91-2 appears in our catalog under these names: 2-Bromo-4-cyanophenylisothiocyanate, 95%, 3–Bromo–4–Isothiocyanato–Benzonitrile. Offered by: Fluorochem, GLPBio. Available pack sizes: 250mg, 1g, 5g.
3-bromo-4-isothiocyanatobenzonitrile (CAS 1000577-91-2) is a chemical compound with the molecular formula C8H3BrN2S and a molecular weight of 239.09 g/mol. IUPAC name: 3-bromo-4-isothiocyanatobenzonitrile. InChIKey: TXSYSARBLBVCHQ-UHFFFAOYSA-N.
| Molecular formula | C8H3BrN2S |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 3-bromo-4-isothiocyanatobenzonitrile |
| InChIKey | TXSYSARBLBVCHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)Br)N=C=S |
Computed by PubChem (NCBI)