CAS 81020-78-2 is the registry number for Propanedinitrile, [(5-bromo-2-thienyl)methylene]-, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[(5-bromothiophen-2-yl)methylidene]propanedinitrile (CAS 81020-78-2) is a chemical compound with the molecular formula C8H3BrN2S and a molecular weight of 239.09 g/mol. IUPAC name: 2-[(5-bromothiophen-2-yl)methylidene]propanedinitrile. InChIKey: GFTOPUBXWAVPQJ-UHFFFAOYSA-N.
| Molecular formula | C8H3BrN2S |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 2-[(5-bromothiophen-2-yl)methylidene]propanedinitrile |
| InChIKey | GFTOPUBXWAVPQJ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C=C(C#N)C#N |
Computed by PubChem (NCBI)