CAS 2629318-67-6 is the registry number for 6-Bromobenzo[d]thiazole-7-carbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-1,3-benzothiazole-7-carbonitrile (CAS 2629318-67-6) is a chemical compound with the molecular formula C8H3BrN2S and a molecular weight of 239.09 g/mol. IUPAC name: 6-bromo-1,3-benzothiazole-7-carbonitrile. InChIKey: RDLRPNDGVYPSDR-UHFFFAOYSA-N.
| Molecular formula | C8H3BrN2S |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 6-bromo-1,3-benzothiazole-7-carbonitrile |
| InChIKey | RDLRPNDGVYPSDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=CS2)C#N)Br |
Computed by PubChem (NCBI)